C27H27NO4S — CID 123186220
2-[[4-[2-(4-butanoylphenyl)ethynyl]anilino]methyl]-3-hydroxy-6-[[methyl(methylidene)-λ4-sulfanyl]methyl]pyran-4-one (PubChem CID 123186220) has the molecular formula C27H27NO4S and a molecular weight of 461.58 g/mol. Its IUPAC name is 2-[[4-[2-(4-butanoylphenyl)ethynyl]anilino]methyl]-3-hydroxy-6-[[methyl(methylidene)-λ4-sulfanyl]methyl]pyran-4-one.
| Compound Name | 2-[[4-[2-(4-butanoylphenyl)ethynyl]anilino]methyl]-3-hydroxy-6-[[methyl(methylidene)-λ4-sulfanyl]methyl]pyran-4-one |
|---|---|
| PubChem CID | 123186220 |
| Molecular Formula | C27H27NO4S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-[[4-[2-(4-butanoylphenyl)ethynyl]anilino]methyl]-3-hydroxy-6-[[methyl(methylidene)-λ4-sulfanyl]methyl]pyran-4-one |
| SMILES | C=S(C)Cc1cc(=O)c(O)c(CNc2ccc(C#Cc3ccc(C(=O)CCC)cc3)cc2)o1 |
| InChI | InChI=1S/C27H27NO4S/c1-4-5-24(29)21-12-8-19(9-13-21)6-7-20-10-14-22(15-11-20)28-17-26-27(31)25(30)16-23(32-26)18-33(2)3/h8-16,28,31H,2,4-5,17-18H2,1,3H3 |
| InChIKey | NBONGPWLYZIFQY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|