C23H23NO5S — CID 123475103
3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-propanoylphenyl)anilino]methyl]pyran-4-one (PubChem CID 123475103) has the molecular formula C23H23NO5S and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-propanoylphenyl)anilino]methyl]pyran-4-one.
| Compound Name | 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-propanoylphenyl)anilino]methyl]pyran-4-one |
|---|---|
| PubChem CID | 123475103 |
| Molecular Formula | C23H23NO5S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-propanoylphenyl)anilino]methyl]pyran-4-one |
| SMILES | CCC(=O)c1ccc(-c2ccc(NCc3oc(CS(C)=O)cc(=O)c3O)cc2)cc1 |
| InChI | InChI=1S/C23H23NO5S/c1-3-20(25)17-6-4-15(5-7-17)16-8-10-18(11-9-16)24-13-22-23(27)21(26)12-19(29-22)14-30(2)28/h4-12,24,27H,3,13-14H2,1-2H3 |
| InChIKey | HVZWFJGRGJVIIU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |