C22H22N2O4S2 — CID 123267870
4-[4-[[6-[[dimethyl(oxo)-λ6-sulfanylidene]methyl]-3-hydroxy-4-sulfanylidenepyran-2-yl]methylamino]phenyl]benzamide (PubChem CID 123267870) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[4-[[6-[[dimethyl(oxo)-λ6-sulfanylidene]methyl]-3-hydroxy-4-sulfanylidenepyran-2-yl]methylamino]phenyl]benzamide.
| Compound Name | 4-[4-[[6-[[dimethyl(oxo)-λ6-sulfanylidene]methyl]-3-hydroxy-4-sulfanylidenepyran-2-yl]methylamino]phenyl]benzamide |
|---|---|
| PubChem CID | 123267870 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 4-[4-[[6-[[dimethyl(oxo)-λ6-sulfanylidene]methyl]-3-hydroxy-4-sulfanylidenepyran-2-yl]methylamino]phenyl]benzamide |
| SMILES | CS(C)(=O)=Cc1cc(=S)c(O)c(CNc2ccc(-c3ccc(C(N)=O)cc3)cc2)o1 |
| InChI | InChI=1S/C22H22N2O4S2/c1-30(2,27)13-18-11-20(29)21(25)19(28-18)12-24-17-9-7-15(8-10-17)14-3-5-16(6-4-14)22(23)26/h3-11,13,24-25H,12H2,1-2H3,(H2,23,26) |
| InChIKey | IGQCDZVZRFQGBX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|