C24H25NO5S — CID 123581640
2-[[4-(4-butanoylphenyl)anilino]methyl]-3-hydroxy-6-(methylsulfinylmethyl)pyran-4-one (PubChem CID 123581640) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is 2-[[4-(4-butanoylphenyl)anilino]methyl]-3-hydroxy-6-(methylsulfinylmethyl)pyran-4-one.
| Compound Name | 2-[[4-(4-butanoylphenyl)anilino]methyl]-3-hydroxy-6-(methylsulfinylmethyl)pyran-4-one |
|---|---|
| PubChem CID | 123581640 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[[4-(4-butanoylphenyl)anilino]methyl]-3-hydroxy-6-(methylsulfinylmethyl)pyran-4-one |
| SMILES | CCCC(=O)c1ccc(-c2ccc(NCc3oc(CS(C)=O)cc(=O)c3O)cc2)cc1 |
| InChI | InChI=1S/C24H25NO5S/c1-3-4-21(26)18-7-5-16(6-8-18)17-9-11-19(12-10-17)25-14-23-24(28)22(27)13-20(30-23)15-31(2)29/h5-13,25,28H,3-4,14-15H2,1-2H3 |
| InChIKey | ZAULFFVNENBZER-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |