C24H19NO4S — CID 123831760
3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-phenylbuta-1,3-diynyl)anilino]methyl]pyran-4-one (PubChem CID 123831760) has the molecular formula C24H19NO4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-phenylbuta-1,3-diynyl)anilino]methyl]pyran-4-one.
| Compound Name | 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-phenylbuta-1,3-diynyl)anilino]methyl]pyran-4-one |
|---|---|
| PubChem CID | 123831760 |
| Molecular Formula | C24H19NO4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 3-hydroxy-6-(methylsulfinylmethyl)-2-[[4-(4-phenylbuta-1,3-diynyl)anilino]methyl]pyran-4-one |
| SMILES | CS(=O)Cc1cc(=O)c(O)c(CNc2ccc(C#CC#Cc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C24H19NO4S/c1-30(28)17-21-15-22(26)24(27)23(29-21)16-25-20-13-11-19(12-14-20)10-6-5-9-18-7-3-2-4-8-18/h2-4,7-8,11-15,25,27H,16-17H2,1H3 |
| InChIKey | YQBVTTWCTCGQJK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|