C9H17NO2 — CID 123663796
N-(2-hydroxypropyl)-2,3-dimethylbut-2-enamide (PubChem CID 123663796) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is N-(2-hydroxypropyl)-2,3-dimethylbut-2-enamide.
| Compound Name | N-(2-hydroxypropyl)-2,3-dimethylbut-2-enamide |
|---|---|
| PubChem CID | 123663796 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-(2-hydroxypropyl)-2,3-dimethylbut-2-enamide |
| SMILES | CC(C)=C(C)C(=O)NCC(C)O |
| InChI | InChI=1S/C9H17NO2/c1-6(2)8(4)9(12)10-5-7(3)11/h7,11H,5H2,1-4H3,(H,10,12) |
| InChIKey | ZKRBQHKZUSYZRG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|