C44H47N3O7Si — CID 123665909
6-phenoxyspiro[3H-chromene-2,3'-oxane]-4-one;(6-phenoxyspiro[3H-chromene-2,3'-oxane]-4-ylidene)cyanamide;N-trimethylsilylethenimine (PubChem CID 123665909) has the molecular formula C44H47N3O7Si and a molecular weight of 757.96 g/mol. Its IUPAC name is 6-phenoxyspiro[3H-chromene-2,3'-oxane]-4-one;(6-phenoxyspiro[3H-chromene-2,3'-oxane]-4-ylidene)cyanamide;N-trimethylsilylethenimine.
| Compound Name | 6-phenoxyspiro[3H-chromene-2,3'-oxane]-4-one;(6-phenoxyspiro[3H-chromene-2,3'-oxane]-4-ylidene)cyanamide;N-trimethylsilylethenimine |
|---|---|
| PubChem CID | 123665909 |
| Molecular Formula | C44H47N3O7Si |
| Molecular Weight | 757.96 g/mol |
| Exact Mass | 757.32 |
| IUPAC Name | 6-phenoxyspiro[3H-chromene-2,3'-oxane]-4-one;(6-phenoxyspiro[3H-chromene-2,3'-oxane]-4-ylidene)cyanamide;N-trimethylsilylethenimine |
| SMILES | C=C=N[Si](C)(C)C.N#C/N=C1\CC2(CCCOC2)Oc2ccc(Oc3ccccc3)cc21.O=C1CC2(CCCOC2)Oc2ccc(Oc3ccccc3)cc21 |
| InChI | InChI=1S/C20H18N2O3.C19H18O4.C5H11NSi/c21-14-22-18-12-20(9-4-10-23-13-20)25-19-8-7-16(11-17(18)19)24-15-5-2-1-3-6-15;20-17-12-19(9-4-10-21-13-19)23-18-8-7-15(11-16(17)18)22-14-5-2-1-3-6-14;1-5-6-7(2,3)4/h1-3,5-8,11H,4,9-10,12-13H2;1-3,5-8,11H,4,9-10,12-13H2;1H2,2-4H3/b22-18+;; |
| InChIKey | ZQRYHTSSHUOBEE-OIWVIQBMSA-N |
| XLogP | 9.75 |
| TPSA | 120.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.96 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|