C24H22N2O4 — CID 108758789
(E)-2-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)-3-phenylprop-2-enenitrile (PubChem CID 108758789) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is (E)-2-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)-3-phenylprop-2-enenitrile.
| Compound Name | (E)-2-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)-3-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 108758789 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | (E)-2-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)-3-phenylprop-2-enenitrile |
| SMILES | COc1ccc2c(c1)C(=O)CC1(CCN(C(=O)/C(C#N)=C/c3ccccc3)CC1)O2 |
| InChI | InChI=1S/C24H22N2O4/c1-29-19-7-8-22-20(14-19)21(27)15-24(30-22)9-11-26(12-10-24)23(28)18(16-25)13-17-5-3-2-4-6-17/h2-8,13-14H,9-12,15H2,1H3/b18-13+ |
| InChIKey | JBOYJCODXLYHSV-QGOAFFKASA-N |
| XLogP | 3.63 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|