C29H27NO4 — CID 108757601
1'-[(E)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108757601) has the molecular formula C29H27NO4 and a molecular weight of 453.54 g/mol. Its IUPAC name is 1'-[(E)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-[(E)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108757601 |
| Molecular Formula | C29H27NO4 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1'-[(E)-3-(4-methoxyphenyl)-2-phenylprop-2-enoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1ccc(/C=C(/C(=O)N2CCC3(CC2)CC(=O)c2ccccc2O3)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H27NO4/c1-33-23-13-11-21(12-14-23)19-25(22-7-3-2-4-8-22)28(32)30-17-15-29(16-18-30)20-26(31)24-9-5-6-10-27(24)34-29/h2-14,19H,15-18,20H2,1H3/b25-19+ |
| InChIKey | TXTHHCOTVYLXOC-NCELDCMTSA-N |
| XLogP | 5.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|