C23H27N2O8+ — CID 123669715
[(4aS,11S)-3-carbamoyl-4a,7,11-trihydroxy-11-methyl-2,4,5,6-tetraoxo-5a,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-trimethylazanium (PubChem CID 123669715) has the molecular formula C23H27N2O8+ and a molecular weight of 459.48 g/mol. Its IUPAC name is [(4aS,11S)-3-carbamoyl-4a,7,11-trihydroxy-11-methyl-2,4,5,6-tetraoxo-5a,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-trimethylazanium.
| Compound Name | [(4aS,11S)-3-carbamoyl-4a,7,11-trihydroxy-11-methyl-2,4,5,6-tetraoxo-5a,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-trimethylazanium |
|---|---|
| PubChem CID | 123669715 |
| Molecular Formula | C23H27N2O8+ |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | [(4aS,11S)-3-carbamoyl-4a,7,11-trihydroxy-11-methyl-2,4,5,6-tetraoxo-5a,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-trimethylazanium |
| SMILES | C[C@@]1(O)c2cccc(O)c2C(=O)C2C(=O)[C@]3(O)C(=O)C(C(N)=O)C(=O)C([N+](C)(C)C)C3CC21 |
| InChI | InChI=1S/C23H26N2O8/c1-22(32)9-6-5-7-12(26)13(9)17(27)14-10(22)8-11-16(25(2,3)4)18(28)15(21(24)31)20(30)23(11,33)19(14)29/h5-7,10-11,14-16,32-33H,8H2,1-4H3,(H2-,24,26,27,31)/p+1/t10?,11?,14?,15?,16?,22-,23+/m1/s1 |
| InChIKey | JJCWPQJDGPQBDU-AJNFJTJOSA-O |
| XLogP | -1.32 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|