C22H24N2O7 — CID 91551899
(4S,12aS)-4-(dimethylamino)-6,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91551899) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is (4S,12aS)-4-(dimethylamino)-6,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aS)-4-(dimethylamino)-6,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91551899 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (4S,12aS)-4-(dimethylamino)-6,12a-dihydroxy-6-methyl-1,3,11,12-tetraoxo-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4ccccc4C(C)(O)C3CC12 |
| InChI | InChI=1S/C22H24N2O7/c1-21(30)10-7-5-4-6-9(10)16(25)13-11(21)8-12-15(24(2)3)17(26)14(20(23)29)19(28)22(12,31)18(13)27/h4-7,11-15,30-31H,8H2,1-3H3,(H2,23,29)/t11?,12?,13?,14?,15-,21?,22-/m0/s1 |
| InChIKey | IQQRGHHTSMUSHE-ZMPVMBRVSA-N |
| XLogP | -1.17 |
| TPSA | 155.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|