C39H32N4O11 — CID 85333534
4-(dimethylamino)-7,9-bis[(1,3-dioxoisoindol-2-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 85333534) has the molecular formula C39H32N4O11 and a molecular weight of 732.70 g/mol. Its IUPAC name is 4-(dimethylamino)-7,9-bis[(1,3-dioxoisoindol-2-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4-(dimethylamino)-7,9-bis[(1,3-dioxoisoindol-2-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 85333534 |
| Molecular Formula | C39H32N4O11 |
| Molecular Weight | 732.70 g/mol |
| Exact Mass | 732.21 |
| IUPAC Name | 4-(dimethylamino)-7,9-bis[(1,3-dioxoisoindol-2-yl)methyl]-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)c(CN5C(=O)c6ccccc6C5=O)cc(CN5C(=O)c6ccccc6C5=O)c4CC3CC12 |
| InChI | InChI=1S/C39H32N4O11/c1-41(2)28-24-13-16-12-23-17(14-42-35(50)19-7-3-4-8-20(19)36(42)51)11-18(15-43-37(52)21-9-5-6-10-22(21)38(43)53)29(44)26(23)30(45)25(16)32(47)39(24,54)33(48)27(31(28)46)34(40)49/h3-11,16,24-25,27-28,44,54H,12-15H2,1-2H3,(H2,40,49) |
| InChIKey | JXCVBCMVTYIJOH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 229.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.70 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|