C30H33N3O9 — CID 91260560
(4S,4aS,5aR,12aS)-4-(dimethylamino)-7-(furan-3-yl)-10,12a-dihydroxy-9-(morpholin-4-ylmethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91260560) has the molecular formula C30H33N3O9 and a molecular weight of 579.61 g/mol. Its IUPAC name is (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-(furan-3-yl)-10,12a-dihydroxy-9-(morpholin-4-ylmethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-(furan-3-yl)-10,12a-dihydroxy-9-(morpholin-4-ylmethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91260560 |
| Molecular Formula | C30H33N3O9 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | (4S,4aS,5aR,12aS)-4-(dimethylamino)-7-(furan-3-yl)-10,12a-dihydroxy-9-(morpholin-4-ylmethyl)-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)C(=O)[C@@]2(O)C(=O)C3C(=O)c4c(O)c(CN5CCOCC5)cc(-c5ccoc5)c4C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C30H33N3O9/c1-32(2)23-19-11-15-9-18-17(14-3-6-42-13-14)10-16(12-33-4-7-41-8-5-33)24(34)21(18)25(35)20(15)27(37)30(19,40)28(38)22(26(23)36)29(31)39/h3,6,10,13,15,19-20,22-23,34,40H,4-5,7-9,11-12H2,1-2H3,(H2,31,39)/t15-,19-,20?,22?,23-,30-/m0/s1 |
| InChIKey | KFABVWLRIPUBEW-PYXGBMCLSA-N |
| XLogP | -0.04 |
| TPSA | 180.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|