C23H25NO8 — CID 91391370
6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4-propan-2-yl-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 91391370) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is 6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4-propan-2-yl-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4-propan-2-yl-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 91391370 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 6,10,12a-trihydroxy-6-methyl-1,3,11,12-tetraoxo-4-propan-2-yl-4a,5,5a,11a-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CC(C)C1C(=O)C(C(N)=O)C(=O)C2(O)C(=O)C3C(=O)c4c(O)cccc4C(C)(O)C3CC12 |
| InChI | InChI=1S/C23H25NO8/c1-8(2)13-11-7-10-15(18(27)14-9(22(10,3)31)5-4-6-12(14)25)19(28)23(11,32)20(29)16(17(13)26)21(24)30/h4-6,8,10-11,13,15-16,25,31-32H,7H2,1-3H3,(H2,24,30) |
| InChIKey | UXZKUFPSTPPTQL-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 172.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|