C19H25F3O3 — CID 123669891
4-propan-2-ylcyclohexan-1-one;2-[3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 123669891) has the molecular formula C19H25F3O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is 4-propan-2-ylcyclohexan-1-one;2-[3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 4-propan-2-ylcyclohexan-1-one;2-[3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 123669891 |
| Molecular Formula | C19H25F3O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 4-propan-2-ylcyclohexan-1-one;2-[3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CC(C(=O)O)c1cccc(C(F)(F)F)c1.CC(C)C1CCC(=O)CC1 |
| InChI | InChI=1S/C10H9F3O2.C9H16O/c1-6(9(14)15)7-3-2-4-8(5-7)10(11,12)13;1-7(2)8-3-5-9(10)6-4-8/h2-6H,1H3,(H,14,15);7-8H,3-6H2,1-2H3 |
| InChIKey | TXTZOUZUNTZPEY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |