C19H15F2N5O2 — CID 123670569
N-[5-(C-ethyl-N-pyridazin-3-yloxycarbonimidoyl)-2-pyridinyl]-2,6-difluorobenzamide (PubChem CID 123670569) has the molecular formula C19H15F2N5O2 and a molecular weight of 383.36 g/mol. Its IUPAC name is N-[5-(C-ethyl-N-pyridazin-3-yloxycarbonimidoyl)-2-pyridinyl]-2,6-difluorobenzamide.
| Compound Name | N-[5-(C-ethyl-N-pyridazin-3-yloxycarbonimidoyl)-2-pyridinyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 123670569 |
| Molecular Formula | C19H15F2N5O2 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-[5-(C-ethyl-N-pyridazin-3-yloxycarbonimidoyl)-2-pyridinyl]-2,6-difluorobenzamide |
| SMILES | CCC(=NOc1cccnn1)c1ccc(NC(=O)c2c(F)cccc2F)nc1 |
| InChI | InChI=1S/C19H15F2N5O2/c1-2-15(26-28-17-7-4-10-23-25-17)12-8-9-16(22-11-12)24-19(27)18-13(20)5-3-6-14(18)21/h3-11H,2H2,1H3,(H,22,24,27) |
| InChIKey | YAYCDWKFLMZKSG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|