C21H15F2N5O2 — CID 123593080
N-[5-[(Z)-C-ethyl-N-[(6-isocyano-3-pyridinyl)oxy]carbonimidoyl]-2-pyridinyl]-2,6-difluorobenzamide (PubChem CID 123593080) has the molecular formula C21H15F2N5O2 and a molecular weight of 407.38 g/mol. Its IUPAC name is N-[5-[(Z)-C-ethyl-N-[(6-isocyano-3-pyridinyl)oxy]carbonimidoyl]-2-pyridinyl]-2,6-difluorobenzamide.
| Compound Name | N-[5-[(Z)-C-ethyl-N-[(6-isocyano-3-pyridinyl)oxy]carbonimidoyl]-2-pyridinyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 123593080 |
| Molecular Formula | C21H15F2N5O2 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[5-[(Z)-C-ethyl-N-[(6-isocyano-3-pyridinyl)oxy]carbonimidoyl]-2-pyridinyl]-2,6-difluorobenzamide |
| SMILES | [C-]#[N+]c1ccc(O/N=C(/CC)c2ccc(NC(=O)c3c(F)cccc3F)nc2)cn1 |
| InChI | InChI=1S/C21H15F2N5O2/c1-3-17(28-30-14-8-10-18(24-2)26-12-14)13-7-9-19(25-11-13)27-21(29)20-15(22)5-4-6-16(20)23/h4-12H,3H2,1H3,(H,25,27,29)/b28-17- |
| InChIKey | UJVXMFWSGYKHSM-QRQIAZFYSA-N |
| XLogP | 4.75 |
| TPSA | 80.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|