C22H19F2N3O2 — CID 89156096
2,6-difluoro-N-[5-[(3E)-3-phenylmethoxyiminopropyl]-2-pyridinyl]benzamide (PubChem CID 89156096) has the molecular formula C22H19F2N3O2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 2,6-difluoro-N-[5-[(3E)-3-phenylmethoxyiminopropyl]-2-pyridinyl]benzamide.
| Compound Name | 2,6-difluoro-N-[5-[(3E)-3-phenylmethoxyiminopropyl]-2-pyridinyl]benzamide |
|---|---|
| PubChem CID | 89156096 |
| Molecular Formula | C22H19F2N3O2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 2,6-difluoro-N-[5-[(3E)-3-phenylmethoxyiminopropyl]-2-pyridinyl]benzamide |
| SMILES | O=C(Nc1ccc(CC/C=N/OCc2ccccc2)cn1)c1c(F)cccc1F |
| InChI | InChI=1S/C22H19F2N3O2/c23-18-9-4-10-19(24)21(18)22(28)27-20-12-11-16(14-25-20)8-5-13-26-29-15-17-6-2-1-3-7-17/h1-4,6-7,9-14H,5,8,15H2,(H,25,27,28)/b26-13+ |
| InChIKey | XODFANKJOZERCB-LGJNPRDNSA-N |
| XLogP | 4.75 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|