C20H13Cl3FN3O2 — CID 171463799
1-N-benzyl-4,5-dichloro-3-N-(5-chloro-2-pyridinyl)-2-fluorobenzene-1,3-dicarboxamide (PubChem CID 171463799) has the molecular formula C20H13Cl3FN3O2 and a molecular weight of 452.70 g/mol. Its IUPAC name is 1-N-benzyl-4,5-dichloro-3-N-(5-chloro-2-pyridinyl)-2-fluorobenzene-1,3-dicarboxamide.
| Compound Name | 1-N-benzyl-4,5-dichloro-3-N-(5-chloro-2-pyridinyl)-2-fluorobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 171463799 |
| Molecular Formula | C20H13Cl3FN3O2 |
| Molecular Weight | 452.70 g/mol |
| Exact Mass | 451.01 |
| IUPAC Name | 1-N-benzyl-4,5-dichloro-3-N-(5-chloro-2-pyridinyl)-2-fluorobenzene-1,3-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1cc(Cl)c(Cl)c(C(=O)Nc2ccc(Cl)cn2)c1F |
| InChI | InChI=1S/C20H13Cl3FN3O2/c21-12-6-7-15(25-10-12)27-20(29)16-17(23)14(22)8-13(18(16)24)19(28)26-9-11-4-2-1-3-5-11/h1-8,10H,9H2,(H,26,28)(H,25,27,29) |
| InChIKey | WMMASFZYNKENJH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.70 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|