C15H13F2N3O3 — CID 53406980
6-[(2,6-difluorobenzoyl)amino]-N-methoxy-N-methylpyridine-3-carboxamide (PubChem CID 53406980) has the molecular formula C15H13F2N3O3 and a molecular weight of 321.28 g/mol. Its IUPAC name is 6-[(2,6-difluorobenzoyl)amino]-N-methoxy-N-methylpyridine-3-carboxamide.
| Compound Name | 6-[(2,6-difluorobenzoyl)amino]-N-methoxy-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 53406980 |
| Molecular Formula | C15H13F2N3O3 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 6-[(2,6-difluorobenzoyl)amino]-N-methoxy-N-methylpyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1ccc(NC(=O)c2c(F)cccc2F)nc1 |
| InChI | InChI=1S/C15H13F2N3O3/c1-20(23-2)15(22)9-6-7-12(18-8-9)19-14(21)13-10(16)4-3-5-11(13)17/h3-8H,1-2H3,(H,18,19,21) |
| InChIKey | IACMVFQFKMFIFR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|