C15H15F2N3O3 — CID 91022800
6-[(2,4-difluorocyclohexa-1,3-diene-1-carbonyl)amino]-N-methoxy-N-methylpyridine-3-carboxamide (PubChem CID 91022800) has the molecular formula C15H15F2N3O3 and a molecular weight of 323.30 g/mol. Its IUPAC name is 6-[(2,4-difluorocyclohexa-1,3-diene-1-carbonyl)amino]-N-methoxy-N-methylpyridine-3-carboxamide.
| Compound Name | 6-[(2,4-difluorocyclohexa-1,3-diene-1-carbonyl)amino]-N-methoxy-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 91022800 |
| Molecular Formula | C15H15F2N3O3 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 6-[(2,4-difluorocyclohexa-1,3-diene-1-carbonyl)amino]-N-methoxy-N-methylpyridine-3-carboxamide |
| SMILES | CON(C)C(=O)c1ccc(NC(=O)C2=C(F)C=C(F)CC2)nc1 |
| InChI | InChI=1S/C15H15F2N3O3/c1-20(23-2)15(22)9-3-6-13(18-8-9)19-14(21)11-5-4-10(16)7-12(11)17/h3,6-8H,4-5H2,1-2H3,(H,18,19,21) |
| InChIKey | CYKXUZZGGTVATQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|