C25H30ClN5O2 — CID 123671172
1-[4-(3-chlorobenzoyl)-2,2-dimethylpiperazin-1-yl]-2-imino-5-[(3-methylphenyl)diazenyl]pentan-1-one (PubChem CID 123671172) has the molecular formula C25H30ClN5O2 and a molecular weight of 468.00 g/mol. Its IUPAC name is 1-[4-(3-chlorobenzoyl)-2,2-dimethylpiperazin-1-yl]-2-imino-5-[(3-methylphenyl)diazenyl]pentan-1-one.
| Compound Name | 1-[4-(3-chlorobenzoyl)-2,2-dimethylpiperazin-1-yl]-2-imino-5-[(3-methylphenyl)diazenyl]pentan-1-one |
|---|---|
| PubChem CID | 123671172 |
| Molecular Formula | C25H30ClN5O2 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 1-[4-(3-chlorobenzoyl)-2,2-dimethylpiperazin-1-yl]-2-imino-5-[(3-methylphenyl)diazenyl]pentan-1-one |
| SMILES | [H]/N=C(\CCC/N=N/c1cccc(C)c1)C(=O)N1CCN(C(=O)c2cccc(Cl)c2)CC1(C)C |
| InChI | InChI=1S/C25H30ClN5O2/c1-18-7-4-10-21(15-18)29-28-12-6-11-22(27)24(33)31-14-13-30(17-25(31,2)3)23(32)19-8-5-9-20(26)16-19/h4-5,7-10,15-16,27H,6,11-14,17H2,1-3H3/b27-22+,29-28+ |
| InChIKey | FZFFCXVWYDVBJI-BKOLAJBNSA-N |
| XLogP | 5.30 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|