C27H24N8O3 — CID 123671374
N-(4-amino-3-methanimidoylphenyl)-3-[8-[(5,6-dimethoxy-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide (PubChem CID 123671374) has the molecular formula C27H24N8O3 and a molecular weight of 508.54 g/mol. Its IUPAC name is N-(4-amino-3-methanimidoylphenyl)-3-[8-[(5,6-dimethoxy-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide.
| Compound Name | N-(4-amino-3-methanimidoylphenyl)-3-[8-[(5,6-dimethoxy-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide |
|---|---|
| PubChem CID | 123671374 |
| Molecular Formula | C27H24N8O3 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | N-(4-amino-3-methanimidoylphenyl)-3-[8-[(5,6-dimethoxy-2-pyridinyl)amino]-[1,2,4]triazolo[1,5-a]pyridin-6-yl]benzamide |
| SMILES | [H]/N=C/c1cc(NC(=O)c2cccc(-c3cc(Nc4ccc(OC)c(OC)n4)c4ncnn4c3)c2)ccc1N |
| InChI | InChI=1S/C27H24N8O3/c1-37-23-8-9-24(34-27(23)38-2)33-22-12-19(14-35-25(22)30-15-31-35)16-4-3-5-17(10-16)26(36)32-20-6-7-21(29)18(11-20)13-28/h3-15,28H,29H2,1-2H3,(H,32,36)(H,33,34)/b28-13+ |
| InChIKey | UNNCQSYNQIKDOU-XODNFHPESA-N |
| XLogP | 4.38 |
| TPSA | 152.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|