C15H17N7O — CID 167446892
(3Z)-1-(4-amino-3-methanimidoylphenyl)-3-[amino-[6-(methylamino)-2-pyridinyl]methylidene]urea (PubChem CID 167446892) has the molecular formula C15H17N7O and a molecular weight of 311.35 g/mol. Its IUPAC name is (3Z)-1-(4-amino-3-methanimidoylphenyl)-3-[amino-[6-(methylamino)-2-pyridinyl]methylidene]urea.
| Compound Name | (3Z)-1-(4-amino-3-methanimidoylphenyl)-3-[amino-[6-(methylamino)-2-pyridinyl]methylidene]urea |
|---|---|
| PubChem CID | 167446892 |
| Molecular Formula | C15H17N7O |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (3Z)-1-(4-amino-3-methanimidoylphenyl)-3-[amino-[6-(methylamino)-2-pyridinyl]methylidene]urea |
| SMILES | [H]/N=C/c1cc(NC(=O)/N=C(\N)c2cccc(NC)n2)ccc1N |
| InChI | InChI=1S/C15H17N7O/c1-19-13-4-2-3-12(21-13)14(18)22-15(23)20-10-5-6-11(17)9(7-10)8-16/h2-8,16H,17H2,1H3,(H,19,21)(H3,18,20,22,23)/b16-8+ |
| InChIKey | CVQVSEYMGZSJCE-LZYBPNLTSA-N |
| XLogP | 1.64 |
| TPSA | 142.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|