C24H34N8O2 — CID 167446972
(3Z)-1-(4-amino-3-methanimidoylphenyl)-3-[amino-[6-(methylamino)-2-pyridinyl]methylidene]urea;butane;(E)-2-methanimidoylbut-2-enal (PubChem CID 167446972) has the molecular formula C24H34N8O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is (3Z)-1-(4-amino-3-methanimidoylphenyl)-3-[amino-[6-(methylamino)-2-pyridinyl]methylidene]urea;butane;(E)-2-methanimidoylbut-2-enal.
| Compound Name | (3Z)-1-(4-amino-3-methanimidoylphenyl)-3-[amino-[6-(methylamino)-2-pyridinyl]methylidene]urea;butane;(E)-2-methanimidoylbut-2-enal |
|---|---|
| PubChem CID | 167446972 |
| Molecular Formula | C24H34N8O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (3Z)-1-(4-amino-3-methanimidoylphenyl)-3-[amino-[6-(methylamino)-2-pyridinyl]methylidene]urea;butane;(E)-2-methanimidoylbut-2-enal |
| SMILES | CCCC.[H]/N=C/C(C=O)=C\C.[H]/N=C/c1cc(NC(=O)/N=C(\N)c2cccc(NC)n2)ccc1N |
| InChI | InChI=1S/C15H17N7O.C5H7NO.C4H10/c1-19-13-4-2-3-12(21-13)14(18)22-15(23)20-10-5-6-11(17)9(7-10)8-16;1-2-5(3-6)4-7;1-3-4-2/h2-8,16H,17H2,1H3,(H,19,21)(H3,18,20,22,23);2-4,6H,1H3;3-4H2,1-2H3/b16-8+;5-2+,6-3+; |
| InChIKey | WNCPIENWGGXGFZ-CXOPSASCSA-N |
| XLogP | 4.23 |
| TPSA | 183.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|