C19H15F3N10O — CID 167447320
N-[6-[3-(4-amino-3-methanimidoylanilino)pyrazol-1-yl]-2-pyridinyl]-5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 167447320) has the molecular formula C19H15F3N10O and a molecular weight of 456.39 g/mol. Its IUPAC name is N-[6-[3-(4-amino-3-methanimidoylanilino)pyrazol-1-yl]-2-pyridinyl]-5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-[6-[3-(4-amino-3-methanimidoylanilino)pyrazol-1-yl]-2-pyridinyl]-5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 167447320 |
| Molecular Formula | C19H15F3N10O |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | N-[6-[3-(4-amino-3-methanimidoylanilino)pyrazol-1-yl]-2-pyridinyl]-5-(trifluoromethyl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | [H]/N=C/c1cc(Nc2ccn(-c3cccc(NC(=O)c4n[nH]c(C(F)(F)F)n4)n3)n2)ccc1N |
| InChI | InChI=1S/C19H15F3N10O/c20-19(21,22)18-28-16(29-30-18)17(33)27-13-2-1-3-15(26-13)32-7-6-14(31-32)25-11-4-5-12(24)10(8-11)9-23/h1-9,23H,24H2,(H,25,31)(H,26,27,33)(H,28,29,30)/b23-9+ |
| InChIKey | CPSAAQGLLYLTEY-NUGSKGIGSA-N |
| XLogP | 2.98 |
| TPSA | 163.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|