C27H22N6O3 — CID 143458156
N-(3-amino-4-methanimidoylphenyl)-2-[2-hydroxy-5-(2-methoxy-3-pyridinyl)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 143458156) has the molecular formula C27H22N6O3 and a molecular weight of 478.51 g/mol. Its IUPAC name is N-(3-amino-4-methanimidoylphenyl)-2-[2-hydroxy-5-(2-methoxy-3-pyridinyl)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(3-amino-4-methanimidoylphenyl)-2-[2-hydroxy-5-(2-methoxy-3-pyridinyl)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143458156 |
| Molecular Formula | C27H22N6O3 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-(3-amino-4-methanimidoylphenyl)-2-[2-hydroxy-5-(2-methoxy-3-pyridinyl)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | [H]/N=C/c1ccc(NC(=O)c2ccc3nc(-c4cc(-c5cccnc5OC)ccc4O)[nH]c3c2)cc1N |
| InChI | InChI=1S/C27H22N6O3/c1-36-27-19(3-2-10-30-27)15-6-9-24(34)20(11-15)25-32-22-8-5-16(12-23(22)33-25)26(35)31-18-7-4-17(14-28)21(29)13-18/h2-14,28,34H,29H2,1H3,(H,31,35)(H,32,33)/b28-14+ |
| InChIKey | YMICJQUBRUSWLE-CCVNUDIWSA-N |
| XLogP | 4.84 |
| TPSA | 150.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|