C24H24N4O3 — CID 143457947
N-(2-hydroxybutyl)-2-[3-(2-methoxy-3-pyridinyl)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 143457947) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-(2-hydroxybutyl)-2-[3-(2-methoxy-3-pyridinyl)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-(2-hydroxybutyl)-2-[3-(2-methoxy-3-pyridinyl)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 143457947 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | N-(2-hydroxybutyl)-2-[3-(2-methoxy-3-pyridinyl)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | CCC(O)CNC(=O)c1ccc2nc(-c3cccc(-c4cccnc4OC)c3)[nH]c2c1 |
| InChI | InChI=1S/C24H24N4O3/c1-3-18(29)14-26-23(30)17-9-10-20-21(13-17)28-22(27-20)16-7-4-6-15(12-16)19-8-5-11-25-24(19)31-2/h4-13,18,29H,3,14H2,1-2H3,(H,26,30)(H,27,28) |
| InChIKey | WBBKACQMNZKIJK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |