C10H13NO4 — CID 123671443
methyl 8-oxo-2,3,5,6,7,8a-hexahydro-1,4-benzoxazine-3-carboxylate (PubChem CID 123671443) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl 8-oxo-2,3,5,6,7,8a-hexahydro-1,4-benzoxazine-3-carboxylate.
| Compound Name | methyl 8-oxo-2,3,5,6,7,8a-hexahydro-1,4-benzoxazine-3-carboxylate |
|---|---|
| PubChem CID | 123671443 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl 8-oxo-2,3,5,6,7,8a-hexahydro-1,4-benzoxazine-3-carboxylate |
| SMILES | COC(=O)C1COC2C(=O)CCCC2=N1 |
| InChI | InChI=1S/C10H13NO4/c1-14-10(13)7-5-15-9-6(11-7)3-2-4-8(9)12/h7,9H,2-5H2,1H3 |
| InChIKey | ARGMNADJMPMFDO-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |