4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid

C14H24O3 — CID 123673404

IUPAC4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid
SMILESC=CCC1OC(CCCC(=O)O)CC(C)C1C
InChIInChI=1S/C14H24O3/c1-4-6-13-11(3)10(2)9-12(17-13)7-5-8-14(15)16/h4,10-13H,1,5-9H2,2-3H3,(H,15,16)
InChIKeyGFCIUASBBQOXMR-UHFFFAOYSA-N
MW240.34 g/mol
LogP3.25
Rot. Bonds6

About 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid

4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid (PubChem CID 123673404) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid.

Molecular Properties

Compound Name4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid
PubChem CID123673404
Molecular FormulaC14H24O3
Molecular Weight240.34 g/mol
Exact Mass240.17
IUPAC Name4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid
SMILESC=CCC1OC(CCCC(=O)O)CC(C)C1C
InChIInChI=1S/C14H24O3/c1-4-6-13-11(3)10(2)9-12(17-13)7-5-8-14(15)16/h4,10-13H,1,5-9H2,2-3H3,(H,15,16)
InChIKeyGFCIUASBBQOXMR-UHFFFAOYSA-N
XLogP3.25
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.34
LogP ≤ 53.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid?
The IUPAC name of 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid (CID 123673404) is 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid.
What is the SMILES notation for 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid?
The canonical SMILES for 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid is C=CCC1OC(CCCC(=O)O)CC(C)C1C.
What is the InChIKey of 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid?
The InChIKey is GFCIUASBBQOXMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3/c1-4-6-13-11(3)10(2)9-12(17-13)7-5-8-14(15)16/h4,10-13H,1,5-9H2,2-3H3,(H,15,16).
What are the key properties of 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid?
4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid has a molecular weight of 240.34 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid is sourced from PubChem (CID 123673404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).