C14H24O3 — CID 123673404
4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid (PubChem CID 123673404) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid.
| Compound Name | 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid |
|---|---|
| PubChem CID | 123673404 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 4-(4,5-dimethyl-6-prop-2-enyloxan-2-yl)butanoic acid |
| SMILES | C=CCC1OC(CCCC(=O)O)CC(C)C1C |
| InChI | InChI=1S/C14H24O3/c1-4-6-13-11(3)10(2)9-12(17-13)7-5-8-14(15)16/h4,10-13H,1,5-9H2,2-3H3,(H,15,16) |
| InChIKey | GFCIUASBBQOXMR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|