C50H41N4O+ — CID 123673830
5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]-8-methoxy-1-methylquinolin-1-ium (PubChem CID 123673830) has the molecular formula C50H41N4O+ and a molecular weight of 713.91 g/mol. Its IUPAC name is 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]-8-methoxy-1-methylquinolin-1-ium.
| Compound Name | 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]-8-methoxy-1-methylquinolin-1-ium |
|---|---|
| PubChem CID | 123673830 |
| Molecular Formula | C50H41N4O+ |
| Molecular Weight | 713.91 g/mol |
| Exact Mass | 713.33 |
| IUPAC Name | 5-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-6,6,12,12-tetramethylindeno[1,2-b]fluoren-8-yl]-8-methoxy-1-methylquinolin-1-ium |
| SMILES | COc1ccc(-c2ccc3c(c2)C(C)(C)c2cc4c(cc2-3)C(C)(C)c2cc(-c3nc(-c5ccccc5)nc(-c5ccccc5)n3)ccc2-4)c2ccc[n+](C)c12 |
| InChI | InChI=1S/C50H41N4O/c1-49(2)40-26-32(34-23-24-44(55-6)45-37(34)18-13-25-54(45)5)19-21-35(40)38-28-43-39(29-42(38)49)36-22-20-33(27-41(36)50(43,3)4)48-52-46(30-14-9-7-10-15-30)51-47(53-48)31-16-11-8-12-17-31/h7-29H,1-6H3/q+1 |
| InChIKey | OMMCKSKVYBLYLN-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 51.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.91 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|