C27H26FN3O4S — CID 123673833
N-ethyl-4-[(6-fluoroquinolin-8-yl)sulfonylamino]-N-(3-hydroxy-3-phenylpropyl)benzamide (PubChem CID 123673833) has the molecular formula C27H26FN3O4S and a molecular weight of 507.59 g/mol. Its IUPAC name is N-ethyl-4-[(6-fluoroquinolin-8-yl)sulfonylamino]-N-(3-hydroxy-3-phenylpropyl)benzamide.
| Compound Name | N-ethyl-4-[(6-fluoroquinolin-8-yl)sulfonylamino]-N-(3-hydroxy-3-phenylpropyl)benzamide |
|---|---|
| PubChem CID | 123673833 |
| Molecular Formula | C27H26FN3O4S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | N-ethyl-4-[(6-fluoroquinolin-8-yl)sulfonylamino]-N-(3-hydroxy-3-phenylpropyl)benzamide |
| SMILES | CCN(CCC(O)c1ccccc1)C(=O)c1ccc(NS(=O)(=O)c2cc(F)cc3cccnc23)cc1 |
| InChI | InChI=1S/C27H26FN3O4S/c1-2-31(16-14-24(32)19-7-4-3-5-8-19)27(33)20-10-12-23(13-11-20)30-36(34,35)25-18-22(28)17-21-9-6-15-29-26(21)25/h3-13,15,17-18,24,30,32H,2,14,16H2,1H3 |
| InChIKey | RJQAKGDOFDSJPE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |