C28H28ClN3O3S — CID 123897685
N-[3-(2-chlorophenyl)propyl]-N-ethyl-2-methyl-4-(quinolin-8-ylsulfonylamino)benzamide (PubChem CID 123897685) has the molecular formula C28H28ClN3O3S and a molecular weight of 522.07 g/mol. Its IUPAC name is N-[3-(2-chlorophenyl)propyl]-N-ethyl-2-methyl-4-(quinolin-8-ylsulfonylamino)benzamide.
| Compound Name | N-[3-(2-chlorophenyl)propyl]-N-ethyl-2-methyl-4-(quinolin-8-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 123897685 |
| Molecular Formula | C28H28ClN3O3S |
| Molecular Weight | 522.07 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | N-[3-(2-chlorophenyl)propyl]-N-ethyl-2-methyl-4-(quinolin-8-ylsulfonylamino)benzamide |
| SMILES | CCN(CCCc1ccccc1Cl)C(=O)c1ccc(NS(=O)(=O)c2cccc3cccnc23)cc1C |
| InChI | InChI=1S/C28H28ClN3O3S/c1-3-32(18-8-12-21-9-4-5-13-25(21)29)28(33)24-16-15-23(19-20(24)2)31-36(34,35)26-14-6-10-22-11-7-17-30-27(22)26/h4-7,9-11,13-17,19,31H,3,8,12,18H2,1-2H3 |
| InChIKey | UVPVOLCGCLQGLZ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.07 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |