C18H10F6N2O3S2 — CID 123673877
3-methyl-4-[2-(trifluoromethylsulfanyloxy)-1-(trifluoromethylsulfonyl)indol-5-yl]benzonitrile (PubChem CID 123673877) has the molecular formula C18H10F6N2O3S2 and a molecular weight of 480.41 g/mol. Its IUPAC name is 3-methyl-4-[2-(trifluoromethylsulfanyloxy)-1-(trifluoromethylsulfonyl)indol-5-yl]benzonitrile.
| Compound Name | 3-methyl-4-[2-(trifluoromethylsulfanyloxy)-1-(trifluoromethylsulfonyl)indol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 123673877 |
| Molecular Formula | C18H10F6N2O3S2 |
| Molecular Weight | 480.41 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 3-methyl-4-[2-(trifluoromethylsulfanyloxy)-1-(trifluoromethylsulfonyl)indol-5-yl]benzonitrile |
| SMILES | Cc1cc(C#N)ccc1-c1ccc2c(c1)cc(OSC(F)(F)F)n2S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H10F6N2O3S2/c1-10-6-11(9-25)2-4-14(10)12-3-5-15-13(7-12)8-16(29-30-17(19,20)21)26(15)31(27,28)18(22,23)24/h2-8H,1H3 |
| InChIKey | SZCBDSNRSNLXAM-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|