C9H10F6O3S — CID 123679712
3-(2-bicyclo[2.2.0]hexanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 123679712) has the molecular formula C9H10F6O3S and a molecular weight of 312.23 g/mol. Its IUPAC name is 3-(2-bicyclo[2.2.0]hexanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-(2-bicyclo[2.2.0]hexanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 123679712 |
| Molecular Formula | C9H10F6O3S |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 3-(2-bicyclo[2.2.0]hexanyl)-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C1CC2CCC21 |
| InChI | InChI=1S/C9H10F6O3S/c10-7(11,6-3-4-1-2-5(4)6)8(12,13)9(14,15)19(16,17)18/h4-6H,1-3H2,(H,16,17,18) |
| InChIKey | ZRFIHQZVLHTYLS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|