C28H24N4O5 — CID 123680977
ethyl (5Z)-2-[2-methyl-4-(pyridin-2-ylmethoxy)phenyl]imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate (PubChem CID 123680977) has the molecular formula C28H24N4O5 and a molecular weight of 496.52 g/mol. Its IUPAC name is ethyl (5Z)-2-[2-methyl-4-(pyridin-2-ylmethoxy)phenyl]imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate.
| Compound Name | ethyl (5Z)-2-[2-methyl-4-(pyridin-2-ylmethoxy)phenyl]imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
|---|---|
| PubChem CID | 123680977 |
| Molecular Formula | C28H24N4O5 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | ethyl (5Z)-2-[2-methyl-4-(pyridin-2-ylmethoxy)phenyl]imino-4-oxo-5-(1H-pyrrolo[2,3-b]pyridin-3-ylmethylidene)oxolane-3-carboxylate |
| SMILES | CCOC(=O)C1C(=O)/C(=C/c2c[nH]c3ncccc23)O/C1=N\c1ccc(OCc2ccccn2)cc1C |
| InChI | InChI=1S/C28H24N4O5/c1-3-35-28(34)24-25(33)23(14-18-15-31-26-21(18)8-6-12-30-26)37-27(24)32-22-10-9-20(13-17(22)2)36-16-19-7-4-5-11-29-19/h4-15,24H,3,16H2,1-2H3,(H,30,31)/b23-14-,32-27- |
| InChIKey | UFYGVXFSFHDKJB-XOUNTWAASA-N |
| XLogP | 4.70 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|