About 6,7-dihydro-5H-quinazolin-1-ium 1-oxide
6,7-dihydro-5H-quinazolin-1-ium 1-oxide (PubChem CID 123681549) has the molecular formula C8H9N2O+
and a molecular weight of 149.17 g/mol. Its IUPAC name is 6,7-dihydro-5H-quinazolin-1-ium 1-oxide.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-quinazolin-1-ium 1-oxide |
| PubChem CID | 123681549 |
| Molecular Formula | C8H9N2O+ |
| Molecular Weight | 149.17 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 6,7-dihydro-5H-quinazolin-1-ium 1-oxide |
| SMILES | O=[N+]1C=NC=C2CCCC=C21 |
| InChI | InChI=1S/C8H9N2O/c11-10-6-9-5-7-3-1-2-4-8(7)10/h4-6H,1-3H2/q+1 |
| InChIKey | WHVKEFXJHARRDR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 32.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.17 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 6,7-dihydro-5H-quinazolin-1-ium 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-quinazolin-1-ium 1-oxide?
The IUPAC name of 6,7-dihydro-5H-quinazolin-1-ium 1-oxide (CID 123681549) is 6,7-dihydro-5H-quinazolin-1-ium 1-oxide.
What is the SMILES notation for 6,7-dihydro-5H-quinazolin-1-ium 1-oxide?
The canonical SMILES for 6,7-dihydro-5H-quinazolin-1-ium 1-oxide is O=[N+]1C=NC=C2CCCC=C21.
What is the InChIKey of 6,7-dihydro-5H-quinazolin-1-ium 1-oxide?
The InChIKey is WHVKEFXJHARRDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N2O/c11-10-6-9-5-7-3-1-2-4-8(7)10/h4-6H,1-3H2/q+1.
What are the key properties of 6,7-dihydro-5H-quinazolin-1-ium 1-oxide?
6,7-dihydro-5H-quinazolin-1-ium 1-oxide has a molecular weight of 149.17 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-quinazolin-1-ium 1-oxide is sourced from PubChem (CID 123681549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).