C12H20N2 — CID 91231787
1,3-dimethyl-6,7-dihydro-5H-quinazolin-3-ium-5-ide;ethane (PubChem CID 91231787) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1,3-dimethyl-6,7-dihydro-5H-quinazolin-3-ium-5-ide;ethane.
| Compound Name | 1,3-dimethyl-6,7-dihydro-5H-quinazolin-3-ium-5-ide;ethane |
|---|---|
| PubChem CID | 91231787 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1,3-dimethyl-6,7-dihydro-5H-quinazolin-3-ium-5-ide;ethane |
| SMILES | CC.CN1C=[N+](C)C=C2[CH-]CCC=C21 |
| InChI | InChI=1S/C10H14N2.C2H6/c1-11-7-9-5-3-4-6-10(9)12(2)8-11;1-2/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | LHJTUCKDPSOYEB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|