C10H11N3 — CID 23541594
1,4-dimethyl-5-methylidenepyrido[2,3-d]pyrimidine (PubChem CID 23541594) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 1,4-dimethyl-5-methylidenepyrido[2,3-d]pyrimidine.
| Compound Name | 1,4-dimethyl-5-methylidenepyrido[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 23541594 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 1,4-dimethyl-5-methylidenepyrido[2,3-d]pyrimidine |
| SMILES | C=c1ccnc2c1=C(C)N=CN2C |
| InChI | InChI=1S/C10H11N3/c1-7-4-5-11-10-9(7)8(2)12-6-13(10)3/h4-6H,1H2,2-3H3 |
| InChIKey | GBFWHANTROJVGY-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |