C10H15N2+ — CID 88884590
1,3-dimethyl-6,7-dihydro-5H-quinazolin-3-ium (PubChem CID 88884590) has the molecular formula C10H15N2+ and a molecular weight of 163.24 g/mol. Its IUPAC name is 1,3-dimethyl-6,7-dihydro-5H-quinazolin-3-ium.
| Compound Name | 1,3-dimethyl-6,7-dihydro-5H-quinazolin-3-ium |
|---|---|
| PubChem CID | 88884590 |
| Molecular Formula | C10H15N2+ |
| Molecular Weight | 163.24 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 1,3-dimethyl-6,7-dihydro-5H-quinazolin-3-ium |
| SMILES | CN1C=[N+](C)C=C2CCCC=C21 |
| InChI | InChI=1S/C10H15N2/c1-11-7-9-5-3-4-6-10(9)12(2)8-11/h6-8H,3-5H2,1-2H3/q+1 |
| InChIKey | DYAQPAVZQKDBOB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.24 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|