C21H29FO3 — CID 123682282
methyl 7-[5-(3-fluorooct-5-enylidene)-4-oxocyclopent-2-en-1-yl]hept-5-enoate (PubChem CID 123682282) has the molecular formula C21H29FO3 and a molecular weight of 348.46 g/mol. Its IUPAC name is methyl 7-[5-(3-fluorooct-5-enylidene)-4-oxocyclopent-2-en-1-yl]hept-5-enoate.
| Compound Name | methyl 7-[5-(3-fluorooct-5-enylidene)-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
|---|---|
| PubChem CID | 123682282 |
| Molecular Formula | C21H29FO3 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | methyl 7-[5-(3-fluorooct-5-enylidene)-4-oxocyclopent-2-en-1-yl]hept-5-enoate |
| SMILES | CCC=CCC(F)CC=C1C(=O)C=CC1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C21H29FO3/c1-3-4-7-11-18(22)14-15-19-17(13-16-20(19)23)10-8-5-6-9-12-21(24)25-2/h4-5,7-8,13,15-18H,3,6,9-12,14H2,1-2H3 |
| InChIKey | HCZBILKLGBKORT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|