C29H34ClN3O5S — CID 123682291
[(3S)-4-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate;6-(2H-pyrrol-4-yl)isoquinoline (PubChem CID 123682291) has the molecular formula C29H34ClN3O5S and a molecular weight of 572.13 g/mol. Its IUPAC name is [(3S)-4-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate;6-(2H-pyrrol-4-yl)isoquinoline.
| Compound Name | [(3S)-4-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate;6-(2H-pyrrol-4-yl)isoquinoline |
|---|---|
| PubChem CID | 123682291 |
| Molecular Formula | C29H34ClN3O5S |
| Molecular Weight | 572.13 g/mol |
| Exact Mass | 571.19 |
| IUPAC Name | [(3S)-4-(4-chlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butyl] methanesulfonate;6-(2H-pyrrol-4-yl)isoquinoline |
| SMILES | C1=NCC=C1c1ccc2cnccc2c1.CC(C)(C)OC(=O)N[C@H](CCOS(C)(=O)=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClNO5S.C13H10N2/c1-16(2,3)23-15(19)18-14(9-10-22-24(4,20)21)11-12-5-7-13(17)8-6-12;1-2-12-8-14-5-3-11(12)7-10(1)13-4-6-15-9-13/h5-8,14H,9-11H2,1-4H3,(H,18,19);1-5,7-9H,6H2/t14-;/m1./s1 |
| InChIKey | RSGNVIJQNJAKQH-PFEQFJNWSA-N |
| XLogP | 5.84 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.13 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|