C26H25BN2O7 — CID 123683553
(4Z,7Z)-2-[4-[[(1R)-4-[(3-methoxy-2-pyridinyl)oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol (PubChem CID 123683553) has the molecular formula C26H25BN2O7 and a molecular weight of 488.31 g/mol. Its IUPAC name is (4Z,7Z)-2-[4-[[(1R)-4-[(3-methoxy-2-pyridinyl)oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol.
| Compound Name | (4Z,7Z)-2-[4-[[(1R)-4-[(3-methoxy-2-pyridinyl)oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
|---|---|
| PubChem CID | 123683553 |
| Molecular Formula | C26H25BN2O7 |
| Molecular Weight | 488.31 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | (4Z,7Z)-2-[4-[[(1R)-4-[(3-methoxy-2-pyridinyl)oxy]-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
| SMILES | COc1cccnc1Oc1cccc2c1CC[C@H]2Oc1ccc(B2O/C(O)=C\N(C)/C=C(/O)O2)cc1 |
| InChI | InChI=1S/C26H25BN2O7/c1-29-15-24(30)35-27(36-25(31)16-29)17-8-10-18(11-9-17)33-22-13-12-20-19(22)5-3-6-21(20)34-26-23(32-2)7-4-14-28-26/h3-11,14-16,22,30-31H,12-13H2,1-2H3/b24-15-,25-16-/t22-/m1/s1 |
| InChIKey | CSFFUVDIABQJGR-SNFKQJCJSA-N |
| XLogP | 4.34 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|