C26H24BNO6 — CID 70938335
6-methyl-2-[4-[[(1R)-4-phenoxy-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 70938335) has the molecular formula C26H24BNO6 and a molecular weight of 457.29 g/mol. Its IUPAC name is 6-methyl-2-[4-[[(1R)-4-phenoxy-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 6-methyl-2-[4-[[(1R)-4-phenoxy-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 70938335 |
| Molecular Formula | C26H24BNO6 |
| Molecular Weight | 457.29 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 6-methyl-2-[4-[[(1R)-4-phenoxy-2,3-dihydro-1H-inden-1-yl]oxy]phenyl]-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(c2ccc(O[C@@H]3CCc4c(Oc5ccccc5)cccc43)cc2)OC(=O)C1 |
| InChI | InChI=1S/C26H24BNO6/c1-28-16-25(29)33-27(34-26(30)17-28)18-10-12-20(13-11-18)32-24-15-14-22-21(24)8-5-9-23(22)31-19-6-3-2-4-7-19/h2-13,24H,14-17H2,1H3/t24-/m1/s1 |
| InChIKey | SMBQCZFJPHFOIE-XMMPIXPASA-N |
| XLogP | 3.27 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|