C20H19BClNO5 — CID 123224029
(4Z)-2-[4-[(4-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol (PubChem CID 123224029) has the molecular formula C20H19BClNO5 and a molecular weight of 399.64 g/mol. Its IUPAC name is (4Z)-2-[4-[(4-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol.
| Compound Name | (4Z)-2-[4-[(4-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
|---|---|
| PubChem CID | 123224029 |
| Molecular Formula | C20H19BClNO5 |
| Molecular Weight | 399.64 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | (4Z)-2-[4-[(4-chloro-2,3-dihydro-1H-inden-1-yl)oxy]phenyl]-6-methyl-1,3,6,2-dioxazaborocine-4,8-diol |
| SMILES | CN1C=C(O)OB(c2ccc(OC3CCc4c(Cl)cccc43)cc2)O/C(O)=C\1 |
| InChI | InChI=1S/C20H19BClNO5/c1-23-11-19(24)27-21(28-20(25)12-23)13-5-7-14(8-6-13)26-18-10-9-15-16(18)3-2-4-17(15)22/h2-8,11-12,18,24-25H,9-10H2,1H3/b19-11-,20-12? |
| InChIKey | QNQGRUPAGZSGKX-HBVRNIDHSA-N |
| XLogP | 3.79 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.64 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|