C15H12Cl2OS — CID 139298700
4-[[(1R)-4,6-dichloro-2,3-dihydro-1H-inden-1-yl]oxy]benzenethiol (PubChem CID 139298700) has the molecular formula C15H12Cl2OS and a molecular weight of 311.23 g/mol. Its IUPAC name is 4-[[(1R)-4,6-dichloro-2,3-dihydro-1H-inden-1-yl]oxy]benzenethiol.
| Compound Name | 4-[[(1R)-4,6-dichloro-2,3-dihydro-1H-inden-1-yl]oxy]benzenethiol |
|---|---|
| PubChem CID | 139298700 |
| Molecular Formula | C15H12Cl2OS |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 4-[[(1R)-4,6-dichloro-2,3-dihydro-1H-inden-1-yl]oxy]benzenethiol |
| SMILES | Sc1ccc(O[C@@H]2CCc3c(Cl)cc(Cl)cc32)cc1 |
| InChI | InChI=1S/C15H12Cl2OS/c16-9-7-13-12(14(17)8-9)5-6-15(13)18-10-1-3-11(19)4-2-10/h1-4,7-8,15,19H,5-6H2/t15-/m1/s1 |
| InChIKey | UPCUHHBIFSDCRS-OAHLLOKOSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|