C24H21N5O — CID 123686026
1-benzyl-3-[4-(3-cyanophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-8-yl]urea (PubChem CID 123686026) has the molecular formula C24H21N5O and a molecular weight of 395.47 g/mol. Its IUPAC name is 1-benzyl-3-[4-(3-cyanophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-8-yl]urea.
| Compound Name | 1-benzyl-3-[4-(3-cyanophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-8-yl]urea |
|---|---|
| PubChem CID | 123686026 |
| Molecular Formula | C24H21N5O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-benzyl-3-[4-(3-cyanophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-8-yl]urea |
| SMILES | N#Cc1cccc(C2=Nc3ccc(NC(=O)NCc4ccccc4)cc3NCC2)c1 |
| InChI | InChI=1S/C24H21N5O/c25-15-18-7-4-8-19(13-18)21-11-12-26-23-14-20(9-10-22(23)29-21)28-24(30)27-16-17-5-2-1-3-6-17/h1-10,13-14,26H,11-12,16H2,(H2,27,28,30) |
| InChIKey | MMMTZAYTYQLHRX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |