C24H20F3N3O — CID 123686536
6-[6-ethoxy-5-(trifluoromethyl)-3-pyridinyl]-4-(3-ethylphenyl)quinazoline (PubChem CID 123686536) has the molecular formula C24H20F3N3O and a molecular weight of 423.44 g/mol. Its IUPAC name is 6-[6-ethoxy-5-(trifluoromethyl)-3-pyridinyl]-4-(3-ethylphenyl)quinazoline.
| Compound Name | 6-[6-ethoxy-5-(trifluoromethyl)-3-pyridinyl]-4-(3-ethylphenyl)quinazoline |
|---|---|
| PubChem CID | 123686536 |
| Molecular Formula | C24H20F3N3O |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 6-[6-ethoxy-5-(trifluoromethyl)-3-pyridinyl]-4-(3-ethylphenyl)quinazoline |
| SMILES | CCOc1ncc(-c2ccc3ncnc(-c4cccc(CC)c4)c3c2)cc1C(F)(F)F |
| InChI | InChI=1S/C24H20F3N3O/c1-3-15-6-5-7-17(10-15)22-19-11-16(8-9-21(19)29-14-30-22)18-12-20(24(25,26)27)23(28-13-18)31-4-2/h5-14H,3-4H2,1-2H3 |
| InChIKey | SMHUXXBBSSOJFX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |