C21H18N4 — CID 141364051
N,3-dimethyl-5-(4-phenylquinazolin-6-yl)pyridin-2-amine (PubChem CID 141364051) has the molecular formula C21H18N4 and a molecular weight of 326.40 g/mol. Its IUPAC name is N,3-dimethyl-5-(4-phenylquinazolin-6-yl)pyridin-2-amine.
| Compound Name | N,3-dimethyl-5-(4-phenylquinazolin-6-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 141364051 |
| Molecular Formula | C21H18N4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N,3-dimethyl-5-(4-phenylquinazolin-6-yl)pyridin-2-amine |
| SMILES | CNc1ncc(-c2ccc3ncnc(-c4ccccc4)c3c2)cc1C |
| InChI | InChI=1S/C21H18N4/c1-14-10-17(12-23-21(14)22-2)16-8-9-19-18(11-16)20(25-13-24-19)15-6-4-3-5-7-15/h3-13H,1-2H3,(H,22,23) |
| InChIKey | FNTPSSYJUKJXEH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |