C23H14ClN5 — CID 164799829
4-[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]quinazoline (PubChem CID 164799829) has the molecular formula C23H14ClN5 and a molecular weight of 395.85 g/mol. Its IUPAC name is 4-[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]quinazoline.
| Compound Name | 4-[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]quinazoline |
|---|---|
| PubChem CID | 164799829 |
| Molecular Formula | C23H14ClN5 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 4-[4-(4-chloro-6-phenyl-1,3,5-triazin-2-yl)phenyl]quinazoline |
| SMILES | Clc1nc(-c2ccccc2)nc(-c2ccc(-c3ncnc4ccccc34)cc2)n1 |
| InChI | InChI=1S/C23H14ClN5/c24-23-28-21(16-6-2-1-3-7-16)27-22(29-23)17-12-10-15(11-13-17)20-18-8-4-5-9-19(18)25-14-26-20/h1-14H |
| InChIKey | URLSDKAMAQXXGW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |